C10H17NO3 — CID 175445075
(3S)-3-(pentylamino)oxane-2,6-dione (PubChem CID 175445075) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is (3S)-3-(pentylamino)oxane-2,6-dione.
| Compound Name | (3S)-3-(pentylamino)oxane-2,6-dione |
|---|---|
| PubChem CID | 175445075 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | (3S)-3-(pentylamino)oxane-2,6-dione |
| SMILES | CCCCCN[C@H]1CCC(=O)OC1=O |
| InChI | InChI=1S/C10H17NO3/c1-2-3-4-7-11-8-5-6-9(12)14-10(8)13/h8,11H,2-7H2,1H3/t8-/m0/s1 |
| InChIKey | HPBOPDPALOIDJN-QMMMGPOBSA-N |
| XLogP | 1.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|