C6H7NO4S — CID 163933241
[(3S)-2,6-dioxooxan-3-yl]carbamothioic S-acid (PubChem CID 163933241) has the molecular formula C6H7NO4S and a molecular weight of 189.19 g/mol. Its IUPAC name is [(3S)-2,6-dioxooxan-3-yl]carbamothioic S-acid.
| Compound Name | [(3S)-2,6-dioxooxan-3-yl]carbamothioic S-acid |
|---|---|
| PubChem CID | 163933241 |
| Molecular Formula | C6H7NO4S |
| Molecular Weight | 189.19 g/mol |
| Exact Mass | 189.01 |
| IUPAC Name | [(3S)-2,6-dioxooxan-3-yl]carbamothioic S-acid |
| SMILES | O=C(S)N[C@H]1CCC(=O)OC1=O |
| InChI | InChI=1S/C6H7NO4S/c8-4-2-1-3(5(9)11-4)7-6(10)12/h3H,1-2H2,(H2,7,10,12)/t3-/m0/s1 |
| InChIKey | RKMWSHUVFFIKOX-VKHMYHEASA-N |
| XLogP | -0.14 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.19 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|