About 1-[[4,5-bis(phenylmethoxy)pyridine-2-carbonyl]amino]-3-(cyanomethyl)urea
1-[[4,5-bis(phenylmethoxy)pyridine-2-carbonyl]amino]-3-(cyanomethyl)urea (PubChem CID 87395926) has the molecular formula C23H21N5O4
and a molecular weight of 431.45 g/mol. Its IUPAC name is 1-[[4,5-bis(phenylmethoxy)pyridine-2-carbonyl]amino]-3-(cyanomethyl)urea.
Molecular Properties
| Compound Name | 1-[[4,5-bis(phenylmethoxy)pyridine-2-carbonyl]amino]-3-(cyanomethyl)urea |
| PubChem CID | 87395926 |
| Molecular Formula | C23H21N5O4 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 1-[[4,5-bis(phenylmethoxy)pyridine-2-carbonyl]amino]-3-(cyanomethyl)urea |
| SMILES | N#CCNC(=O)NNC(=O)c1cc(OCc2ccccc2)c(OCc2ccccc2)cn1 |
| InChI | InChI=1S/C23H21N5O4/c24-11-12-25-23(30)28-27-22(29)19-13-20(31-15-17-7-3-1-4-8-17)21(14-26-19)32-16-18-9-5-2-6-10-18/h1-10,13-14H,12,15-16H2,(H,27,29)(H2,25,28,30) |
| InChIKey | JGOKIONCWQFOTA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[[4,5-bis(phenylmethoxy)pyridine-2-carbonyl]amino]-3-(cyanomethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4,5-bis(phenylmethoxy)pyridine-2-carbonyl]amino]-3-(cyanomethyl)urea?
The IUPAC name of 1-[[4,5-bis(phenylmethoxy)pyridine-2-carbonyl]amino]-3-(cyanomethyl)urea (CID 87395926) is 1-[[4,5-bis(phenylmethoxy)pyridine-2-carbonyl]amino]-3-(cyanomethyl)urea.
What is the SMILES notation for 1-[[4,5-bis(phenylmethoxy)pyridine-2-carbonyl]amino]-3-(cyanomethyl)urea?
The canonical SMILES for 1-[[4,5-bis(phenylmethoxy)pyridine-2-carbonyl]amino]-3-(cyanomethyl)urea is N#CCNC(=O)NNC(=O)c1cc(OCc2ccccc2)c(OCc2ccccc2)cn1.
What is the InChIKey of 1-[[4,5-bis(phenylmethoxy)pyridine-2-carbonyl]amino]-3-(cyanomethyl)urea?
The InChIKey is JGOKIONCWQFOTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21N5O4/c24-11-12-25-23(30)28-27-22(29)19-13-20(31-15-17-7-3-1-4-8-17)21(14-26-19)32-16-18-9-5-2-6-10-18/h1-10,13-14H,12,15-16H2,(H,27,29)(H2,25,28,30).
What are the key properties of 1-[[4,5-bis(phenylmethoxy)pyridine-2-carbonyl]amino]-3-(cyanomethyl)urea?
1-[[4,5-bis(phenylmethoxy)pyridine-2-carbonyl]amino]-3-(cyanomethyl)urea has a molecular weight of 431.45 g/mol, XLogP of 2.71, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4,5-bis(phenylmethoxy)pyridine-2-carbonyl]amino]-3-(cyanomethyl)urea is sourced from PubChem (CID 87395926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).