C24H26N4O6 — CID 67427761
1-[[4,5-bis(phenylmethoxy)pyridine-2-carbonyl]amino]-1-[(2R)-2,3-dihydroxypropyl]urea (PubChem CID 67427761) has the molecular formula C24H26N4O6 and a molecular weight of 466.49 g/mol. Its IUPAC name is 1-[[4,5-bis(phenylmethoxy)pyridine-2-carbonyl]amino]-1-[(2R)-2,3-dihydroxypropyl]urea.
| Compound Name | 1-[[4,5-bis(phenylmethoxy)pyridine-2-carbonyl]amino]-1-[(2R)-2,3-dihydroxypropyl]urea |
|---|---|
| PubChem CID | 67427761 |
| Molecular Formula | C24H26N4O6 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 1-[[4,5-bis(phenylmethoxy)pyridine-2-carbonyl]amino]-1-[(2R)-2,3-dihydroxypropyl]urea |
| SMILES | NC(=O)N(C[C@@H](O)CO)NC(=O)c1cc(OCc2ccccc2)c(OCc2ccccc2)cn1 |
| InChI | InChI=1S/C24H26N4O6/c25-24(32)28(13-19(30)14-29)27-23(31)20-11-21(33-15-17-7-3-1-4-8-17)22(12-26-20)34-16-18-9-5-2-6-10-18/h1-12,19,29-30H,13-16H2,(H2,25,32)(H,27,31)/t19-/m1/s1 |
| InChIKey | XSUXAJYAQSCMER-LJQANCHMSA-N |
| XLogP | 1.62 |
| TPSA | 147.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|