C23H21N5O4 — CID 59374360
1-[[4,5-bis(phenylmethoxy)pyridine-2-carbonyl]amino]-3-(isocyanomethyl)urea (PubChem CID 59374360) has the molecular formula C23H21N5O4 and a molecular weight of 431.45 g/mol. Its IUPAC name is 1-[[4,5-bis(phenylmethoxy)pyridine-2-carbonyl]amino]-3-(isocyanomethyl)urea.
| Compound Name | 1-[[4,5-bis(phenylmethoxy)pyridine-2-carbonyl]amino]-3-(isocyanomethyl)urea |
|---|---|
| PubChem CID | 59374360 |
| Molecular Formula | C23H21N5O4 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 1-[[4,5-bis(phenylmethoxy)pyridine-2-carbonyl]amino]-3-(isocyanomethyl)urea |
| SMILES | [C-]#[N+]CNC(=O)NNC(=O)c1cc(OCc2ccccc2)c(OCc2ccccc2)cn1 |
| InChI | InChI=1S/C23H21N5O4/c1-24-16-26-23(30)28-27-22(29)19-12-20(31-14-17-8-4-2-5-9-17)21(13-25-19)32-15-18-10-6-3-7-11-18/h2-13H,14-16H2,(H,27,29)(H2,26,28,30) |
| InChIKey | WBHGGUIIGCOUTC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 105.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|