C23H25N3O5 — CID 141272415
N'-[(2S)-2,3-dihydroxypropyl]-4,5-bis(phenylmethoxy)pyridine-2-carbohydrazide (PubChem CID 141272415) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is N'-[(2S)-2,3-dihydroxypropyl]-4,5-bis(phenylmethoxy)pyridine-2-carbohydrazide.
| Compound Name | N'-[(2S)-2,3-dihydroxypropyl]-4,5-bis(phenylmethoxy)pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 141272415 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | N'-[(2S)-2,3-dihydroxypropyl]-4,5-bis(phenylmethoxy)pyridine-2-carbohydrazide |
| SMILES | O=C(NNC[C@H](O)CO)c1cc(OCc2ccccc2)c(OCc2ccccc2)cn1 |
| InChI | InChI=1S/C23H25N3O5/c27-14-19(28)12-25-26-23(29)20-11-21(30-15-17-7-3-1-4-8-17)22(13-24-20)31-16-18-9-5-2-6-10-18/h1-11,13,19,25,27-28H,12,14-16H2,(H,26,29)/t19-/m0/s1 |
| InChIKey | LTZZEGLCPNQSGJ-IBGZPJMESA-N |
| XLogP | 1.83 |
| TPSA | 112.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|