C37H33F3N8O5S — CID 87399754
N-[7-(2-methoxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]-1-methyl-3,4-dihydro-2H-quinolin-7-amine;[7-(2-methoxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl] trifluoromethanesulfonate (PubChem CID 87399754) has the molecular formula C37H33F3N8O5S and a molecular weight of 758.78 g/mol. Its IUPAC name is N-[7-(2-methoxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]-1-methyl-3,4-dihydro-2H-quinolin-7-amine;[7-(2-methoxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl] trifluoromethanesulfonate.
| Compound Name | N-[7-(2-methoxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]-1-methyl-3,4-dihydro-2H-quinolin-7-amine;[7-(2-methoxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87399754 |
| Molecular Formula | C37H33F3N8O5S |
| Molecular Weight | 758.78 g/mol |
| Exact Mass | 758.22 |
| IUPAC Name | N-[7-(2-methoxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl]-1-methyl-3,4-dihydro-2H-quinolin-7-amine;[7-(2-methoxyphenyl)pyrrolo[2,1-f][1,2,4]triazin-2-yl] trifluoromethanesulfonate |
| SMILES | COc1ccccc1-c1ccc2cnc(Nc3ccc4c(c3)N(C)CCC4)nn12.COc1ccccc1-c1ccc2cnc(OS(=O)(=O)C(F)(F)F)nn12 |
| InChI | InChI=1S/C23H23N5O.C14H10F3N3O4S/c1-27-13-5-6-16-9-10-17(14-21(16)27)25-23-24-15-18-11-12-20(28(18)26-23)19-7-3-4-8-22(19)29-2;1-23-12-5-3-2-4-10(12)11-7-6-9-8-18-13(19-20(9)11)24-25(21,22)14(15,16)17/h3-4,7-12,14-15H,5-6,13H2,1-2H3,(H,25,26);2-8H,1H3 |
| InChIKey | XBELTEBDXQBWGE-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 137.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.78 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|