C21H26FN3O5S — CID 87404270
tert-butyl N-[1-[4-fluoro-2-(3-methylsulfonylanilino)anilino]-3-oxopropan-2-yl]carbamate (PubChem CID 87404270) has the molecular formula C21H26FN3O5S and a molecular weight of 451.52 g/mol. Its IUPAC name is tert-butyl N-[1-[4-fluoro-2-(3-methylsulfonylanilino)anilino]-3-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-fluoro-2-(3-methylsulfonylanilino)anilino]-3-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 87404270 |
| Molecular Formula | C21H26FN3O5S |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | tert-butyl N-[1-[4-fluoro-2-(3-methylsulfonylanilino)anilino]-3-oxopropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C=O)CNc1ccc(F)cc1Nc1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C21H26FN3O5S/c1-21(2,3)30-20(27)25-16(13-26)12-23-18-9-8-14(22)10-19(18)24-15-6-5-7-17(11-15)31(4,28)29/h5-11,13,16,23-24H,12H2,1-4H3,(H,25,27) |
| InChIKey | CWDMPTQTCNFYEE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|