C20H23N3O4S2 — CID 140546213
tert-butyl N-[3-(2-cyano-3-methyl-4-methylsulfanylanilino)phenyl]sulfonylcarbamate (PubChem CID 140546213) has the molecular formula C20H23N3O4S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is tert-butyl N-[3-(2-cyano-3-methyl-4-methylsulfanylanilino)phenyl]sulfonylcarbamate.
| Compound Name | tert-butyl N-[3-(2-cyano-3-methyl-4-methylsulfanylanilino)phenyl]sulfonylcarbamate |
|---|---|
| PubChem CID | 140546213 |
| Molecular Formula | C20H23N3O4S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | tert-butyl N-[3-(2-cyano-3-methyl-4-methylsulfanylanilino)phenyl]sulfonylcarbamate |
| SMILES | CSc1ccc(Nc2cccc(S(=O)(=O)NC(=O)OC(C)(C)C)c2)c(C#N)c1C |
| InChI | InChI=1S/C20H23N3O4S2/c1-13-16(12-21)17(9-10-18(13)28-5)22-14-7-6-8-15(11-14)29(25,26)23-19(24)27-20(2,3)4/h6-11,22H,1-5H3,(H,23,24) |
| InChIKey | JOOZUIHJRSDITJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |