C27H30ClF3N4O4S — CID 87410059
butanedioic acid;4-[4-[[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)amino]methyl]phenyl]-N-(3,3,3-trifluoropropyl)-1,3-thiazol-2-amine (PubChem CID 87410059) has the molecular formula C27H30ClF3N4O4S and a molecular weight of 599.08 g/mol. Its IUPAC name is butanedioic acid;4-[4-[[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)amino]methyl]phenyl]-N-(3,3,3-trifluoropropyl)-1,3-thiazol-2-amine.
| Compound Name | butanedioic acid;4-[4-[[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)amino]methyl]phenyl]-N-(3,3,3-trifluoropropyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 87410059 |
| Molecular Formula | C27H30ClF3N4O4S |
| Molecular Weight | 599.08 g/mol |
| Exact Mass | 598.16 |
| IUPAC Name | butanedioic acid;4-[4-[[(7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-yl)amino]methyl]phenyl]-N-(3,3,3-trifluoropropyl)-1,3-thiazol-2-amine |
| SMILES | FC(F)(F)CCNc1nc(-c2ccc(CNc3c(Cl)ccc4c3CCNCC4)cc2)cs1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C23H24ClF3N4S.C4H6O4/c24-19-6-5-16-7-10-28-11-8-18(16)21(19)30-13-15-1-3-17(4-2-15)20-14-32-22(31-20)29-12-9-23(25,26)27;5-3(6)1-2-4(7)8/h1-6,14,28,30H,7-13H2,(H,29,31);1-2H2,(H,5,6)(H,7,8) |
| InChIKey | HZSNJLHPCXRQEX-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.08 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |