C27H26ClF3N4O4S — CID 140531074
8-chloro-9-[[4-[2-(3,3,3-trifluoropropylamino)-1,3-thiazol-4-yl]phenyl]methylamino]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione (PubChem CID 140531074) has the molecular formula C27H26ClF3N4O4S and a molecular weight of 595.04 g/mol. Its IUPAC name is 8-chloro-9-[[4-[2-(3,3,3-trifluoropropylamino)-1,3-thiazol-4-yl]phenyl]methylamino]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione.
| Compound Name | 8-chloro-9-[[4-[2-(3,3,3-trifluoropropylamino)-1,3-thiazol-4-yl]phenyl]methylamino]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione |
|---|---|
| PubChem CID | 140531074 |
| Molecular Formula | C27H26ClF3N4O4S |
| Molecular Weight | 595.04 g/mol |
| Exact Mass | 594.13 |
| IUPAC Name | 8-chloro-9-[[4-[2-(3,3,3-trifluoropropylamino)-1,3-thiazol-4-yl]phenyl]methylamino]spiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione |
| SMILES | O=C1CCC(=O)OC2(CNCCc3c2ccc(Cl)c3NCc2ccc(-c3csc(NCCC(F)(F)F)n3)cc2)O1 |
| InChI | InChI=1S/C27H26ClF3N4O4S/c28-20-6-5-19-18(9-11-32-15-26(19)38-22(36)7-8-23(37)39-26)24(20)34-13-16-1-3-17(4-2-16)21-14-40-25(35-21)33-12-10-27(29,30)31/h1-6,14,32,34H,7-13,15H2,(H,33,35) |
| InChIKey | XLZFWERPELTGAP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.04 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |