C22H20ClN3O5 — CID 140568042
9-(1,3-benzoxazol-6-ylmethylamino)-8-chlorospiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione (PubChem CID 140568042) has the molecular formula C22H20ClN3O5 and a molecular weight of 441.87 g/mol. Its IUPAC name is 9-(1,3-benzoxazol-6-ylmethylamino)-8-chlorospiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione.
| Compound Name | 9-(1,3-benzoxazol-6-ylmethylamino)-8-chlorospiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione |
|---|---|
| PubChem CID | 140568042 |
| Molecular Formula | C22H20ClN3O5 |
| Molecular Weight | 441.87 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 9-(1,3-benzoxazol-6-ylmethylamino)-8-chlorospiro[1,2,3,4-tetrahydro-3-benzazepine-5,2'-1,3-dioxepane]-4',7'-dione |
| SMILES | O=C1CCC(=O)OC2(CNCCc3c2ccc(Cl)c3NCc2ccc3ncoc3c2)O1 |
| InChI | InChI=1S/C22H20ClN3O5/c23-16-3-2-15-14(7-8-24-11-22(15)30-19(27)5-6-20(28)31-22)21(16)25-10-13-1-4-17-18(9-13)29-12-26-17/h1-4,9,12,24-25H,5-8,10-11H2 |
| InChIKey | MHECCHMXBSTCIA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.87 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |