About ethyl 2-(2-aminoethyl)-4-(methylamino)-3-oxobutanoate;2,2,2-trifluoroacetic acid
ethyl 2-(2-aminoethyl)-4-(methylamino)-3-oxobutanoate;2,2,2-trifluoroacetic acid (PubChem CID 87410280) has the molecular formula C11H19F3N2O5
and a molecular weight of 316.28 g/mol. Its IUPAC name is ethyl 2-(2-aminoethyl)-4-(methylamino)-3-oxobutanoate;2,2,2-trifluoroacetic acid.
Molecular Properties
| Compound Name | ethyl 2-(2-aminoethyl)-4-(methylamino)-3-oxobutanoate;2,2,2-trifluoroacetic acid |
| PubChem CID | 87410280 |
| Molecular Formula | C11H19F3N2O5 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | ethyl 2-(2-aminoethyl)-4-(methylamino)-3-oxobutanoate;2,2,2-trifluoroacetic acid |
| SMILES | CCOC(=O)C(CCN)C(=O)CNC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H18N2O3.C2HF3O2/c1-3-14-9(13)7(4-5-10)8(12)6-11-2;3-2(4,5)1(6)7/h7,11H,3-6,10H2,1-2H3;(H,6,7) |
| InChIKey | XDLKTVKQRWIGSO-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(2-aminoethyl)-4-(methylamino)-3-oxobutanoate;2,2,2-trifluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2-aminoethyl)-4-(methylamino)-3-oxobutanoate;2,2,2-trifluoroacetic acid?
The IUPAC name of ethyl 2-(2-aminoethyl)-4-(methylamino)-3-oxobutanoate;2,2,2-trifluoroacetic acid (CID 87410280) is ethyl 2-(2-aminoethyl)-4-(methylamino)-3-oxobutanoate;2,2,2-trifluoroacetic acid.
What is the SMILES notation for ethyl 2-(2-aminoethyl)-4-(methylamino)-3-oxobutanoate;2,2,2-trifluoroacetic acid?
The canonical SMILES for ethyl 2-(2-aminoethyl)-4-(methylamino)-3-oxobutanoate;2,2,2-trifluoroacetic acid is CCOC(=O)C(CCN)C(=O)CNC.O=C(O)C(F)(F)F.
What is the InChIKey of ethyl 2-(2-aminoethyl)-4-(methylamino)-3-oxobutanoate;2,2,2-trifluoroacetic acid?
The InChIKey is XDLKTVKQRWIGSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O3.C2HF3O2/c1-3-14-9(13)7(4-5-10)8(12)6-11-2;3-2(4,5)1(6)7/h7,11H,3-6,10H2,1-2H3;(H,6,7).
What are the key properties of ethyl 2-(2-aminoethyl)-4-(methylamino)-3-oxobutanoate;2,2,2-trifluoroacetic acid?
ethyl 2-(2-aminoethyl)-4-(methylamino)-3-oxobutanoate;2,2,2-trifluoroacetic acid has a molecular weight of 316.28 g/mol, XLogP of -0.06, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2-aminoethyl)-4-(methylamino)-3-oxobutanoate;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 87410280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).