C11H19F3N2O5 — CID 87410280
ethyl 2-(2-aminoethyl)-4-(methylamino)-3-oxobutanoate;2,2,2-trifluoroacetic acid (PubChem CID 87410280) has the molecular formula C11H19F3N2O5 and a molecular weight of 316.28 g/mol. Its IUPAC name is ethyl 2-(2-aminoethyl)-4-(methylamino)-3-oxobutanoate;2,2,2-trifluoroacetic acid.
| Compound Name | ethyl 2-(2-aminoethyl)-4-(methylamino)-3-oxobutanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87410280 |
| Molecular Formula | C11H19F3N2O5 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | ethyl 2-(2-aminoethyl)-4-(methylamino)-3-oxobutanoate;2,2,2-trifluoroacetic acid |
| SMILES | CCOC(=O)C(CCN)C(=O)CNC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H18N2O3.C2HF3O2/c1-3-14-9(13)7(4-5-10)8(12)6-11-2;3-2(4,5)1(6)7/h7,11H,3-6,10H2,1-2H3;(H,6,7) |
| InChIKey | XDLKTVKQRWIGSO-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|