C21H20N6O2 — CID 87412078
2-[(6S)-6-(4-isocyanophenyl)-1,4-oxazepan-4-yl]-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one (PubChem CID 87412078) has the molecular formula C21H20N6O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is 2-[(6S)-6-(4-isocyanophenyl)-1,4-oxazepan-4-yl]-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one.
| Compound Name | 2-[(6S)-6-(4-isocyanophenyl)-1,4-oxazepan-4-yl]-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one |
|---|---|
| PubChem CID | 87412078 |
| Molecular Formula | C21H20N6O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2-[(6S)-6-(4-isocyanophenyl)-1,4-oxazepan-4-yl]-3-methyl-6-pyrimidin-4-ylpyrimidin-4-one |
| SMILES | [C-]#[N+]c1ccc([C@@H]2COCCN(c3nc(-c4ccncn4)cc(=O)n3C)C2)cc1 |
| InChI | InChI=1S/C21H20N6O2/c1-22-17-5-3-15(4-6-17)16-12-27(9-10-29-13-16)21-25-19(11-20(28)26(21)2)18-7-8-23-14-24-18/h3-8,11,14,16H,9-10,12-13H2,2H3/t16-/m0/s1 |
| InChIKey | PYWUFGFQPJCHJW-INIZCTEOSA-N |
| XLogP | 2.41 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|