C16H30N4O4S — CID 87412613
4-[4-[carbamoyl(cyclohexyl)amino]piperidin-1-yl]-4-oxobutane-1-sulfonimidic acid (PubChem CID 87412613) has the molecular formula C16H30N4O4S and a molecular weight of 374.51 g/mol. Its IUPAC name is 4-[4-[carbamoyl(cyclohexyl)amino]piperidin-1-yl]-4-oxobutane-1-sulfonimidic acid.
| Compound Name | 4-[4-[carbamoyl(cyclohexyl)amino]piperidin-1-yl]-4-oxobutane-1-sulfonimidic acid |
|---|---|
| PubChem CID | 87412613 |
| Molecular Formula | C16H30N4O4S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 4-[4-[carbamoyl(cyclohexyl)amino]piperidin-1-yl]-4-oxobutane-1-sulfonimidic acid |
| SMILES | [H]N=S(=O)(O)CCCC(=O)N1CCC(N(C(N)=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C16H30N4O4S/c17-16(22)20(13-5-2-1-3-6-13)14-8-10-19(11-9-14)15(21)7-4-12-25(18,23)24/h13-14H,1-12H2,(H2,17,22)(H2,18,23,24) |
| InChIKey | CSHHXAKAUZTMGB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |