C18H24N7O14P3S — CID 87414059
[hydroxy-[[2-[(1-methylpyrazol-4-yl)methylcarbamoyl]-4-(2-methyl-6-sulfanylidene-3H-purin-9-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]phosphoryl] phosphono hydrogen phosphate (PubChem CID 87414059) has the molecular formula C18H24N7O14P3S and a molecular weight of 687.41 g/mol. Its IUPAC name is [hydroxy-[[2-[(1-methylpyrazol-4-yl)methylcarbamoyl]-4-(2-methyl-6-sulfanylidene-3H-purin-9-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]phosphoryl] phosphono hydrogen phosphate.
| Compound Name | [hydroxy-[[2-[(1-methylpyrazol-4-yl)methylcarbamoyl]-4-(2-methyl-6-sulfanylidene-3H-purin-9-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 87414059 |
| Molecular Formula | C18H24N7O14P3S |
| Molecular Weight | 687.41 g/mol |
| Exact Mass | 687.03 |
| IUPAC Name | [hydroxy-[[2-[(1-methylpyrazol-4-yl)methylcarbamoyl]-4-(2-methyl-6-sulfanylidene-3H-purin-9-yl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]phosphoryl] phosphono hydrogen phosphate |
| SMILES | Cc1nc(=S)c2ncn(C3OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C4OC(C(=O)NCc5cnn(C)c5)OC43)c2[nH]1 |
| InChI | InChI=1S/C18H24N7O14P3S/c1-8-22-14-11(16(43)23-8)20-7-25(14)17-13-12(36-18(37-13)15(26)19-3-9-4-21-24(2)5-9)10(35-17)6-34-41(30,31)39-42(32,33)38-40(27,28)29/h4-5,7,10,12-13,17-18H,3,6H2,1-2H3,(H,19,26)(H,30,31)(H,32,33)(H,22,23,43)(H2,27,28,29) |
| InChIKey | DEUMUWXFPPQQLA-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 280.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.41 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|