C20H21NO4 — CID 8741427
N-[(2R)-2-(4-methoxyphenyl)-4-oxo-2,3-dihydrochromen-6-yl]butanamide (PubChem CID 8741427) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is N-[(2R)-2-(4-methoxyphenyl)-4-oxo-2,3-dihydrochromen-6-yl]butanamide.
| Compound Name | N-[(2R)-2-(4-methoxyphenyl)-4-oxo-2,3-dihydrochromen-6-yl]butanamide |
|---|---|
| PubChem CID | 8741427 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | N-[(2R)-2-(4-methoxyphenyl)-4-oxo-2,3-dihydrochromen-6-yl]butanamide |
| SMILES | CCCC(=O)Nc1ccc2c(c1)C(=O)C[C@H](c1ccc(OC)cc1)O2 |
| InChI | InChI=1S/C20H21NO4/c1-3-4-20(23)21-14-7-10-18-16(11-14)17(22)12-19(25-18)13-5-8-15(24-2)9-6-13/h5-11,19H,3-4,12H2,1-2H3,(H,21,23)/t19-/m1/s1 |
| InChIKey | XIWHMXQTJHZKHK-LJQANCHMSA-N |
| XLogP | 4.14 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |