C9H11FN2O4S — CID 87415499
(3R,4R)-4-(2,4-dioxo-1,3-thiazolidin-3-yl)-3-fluoropiperidine-1-carboxylic acid (PubChem CID 87415499) has the molecular formula C9H11FN2O4S and a molecular weight of 262.26 g/mol. Its IUPAC name is (3R,4R)-4-(2,4-dioxo-1,3-thiazolidin-3-yl)-3-fluoropiperidine-1-carboxylic acid.
| Compound Name | (3R,4R)-4-(2,4-dioxo-1,3-thiazolidin-3-yl)-3-fluoropiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87415499 |
| Molecular Formula | C9H11FN2O4S |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | (3R,4R)-4-(2,4-dioxo-1,3-thiazolidin-3-yl)-3-fluoropiperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CC[C@@H](N2C(=O)CSC2=O)[C@H](F)C1 |
| InChI | InChI=1S/C9H11FN2O4S/c10-5-3-11(8(14)15)2-1-6(5)12-7(13)4-17-9(12)16/h5-6H,1-4H2,(H,14,15)/t5-,6-/m1/s1 |
| InChIKey | XSKRKTKFRGJEII-PHDIDXHHSA-N |
| XLogP | 0.77 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|