C13H28NO2+ — CID 8741573
cyclohexyl-[(2R)-2-hydroxy-3-[(2-methylpropan-2-yl)oxy]propyl]azanium (PubChem CID 8741573) has the molecular formula C13H28NO2+ and a molecular weight of 230.37 g/mol. Its IUPAC name is cyclohexyl-[(2R)-2-hydroxy-3-[(2-methylpropan-2-yl)oxy]propyl]azanium.
| Compound Name | cyclohexyl-[(2R)-2-hydroxy-3-[(2-methylpropan-2-yl)oxy]propyl]azanium |
|---|---|
| PubChem CID | 8741573 |
| Molecular Formula | C13H28NO2+ |
| Molecular Weight | 230.37 g/mol |
| Exact Mass | 230.21 |
| IUPAC Name | cyclohexyl-[(2R)-2-hydroxy-3-[(2-methylpropan-2-yl)oxy]propyl]azanium |
| SMILES | CC(C)(C)OC[C@H](O)C[NH2+]C1CCCCC1 |
| InChI | InChI=1S/C13H27NO2/c1-13(2,3)16-10-12(15)9-14-11-7-5-4-6-8-11/h11-12,14-15H,4-10H2,1-3H3/p+1/t12-/m1/s1 |
| InChIKey | GCKSLZXHJMZOTL-GFCCVEGCSA-O |
| XLogP | 1.06 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |