C13H23F6NO7S — CID 87415779
6-amino-2,2-dimethylheptane-3-sulfonic acid;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87415779) has the molecular formula C13H23F6NO7S and a molecular weight of 451.38 g/mol. Its IUPAC name is 6-amino-2,2-dimethylheptane-3-sulfonic acid;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 6-amino-2,2-dimethylheptane-3-sulfonic acid;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87415779 |
| Molecular Formula | C13H23F6NO7S |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 6-amino-2,2-dimethylheptane-3-sulfonic acid;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CC(N)CCC(C(C)(C)C)S(=O)(=O)O.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C9H21NO3S.2C2HF3O2/c1-7(10)5-6-8(9(2,3)4)14(11,12)13;2*3-2(4,5)1(6)7/h7-8H,5-6,10H2,1-4H3,(H,11,12,13);2*(H,6,7) |
| InChIKey | ZDSXHNMODVCWCC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 154.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|