C16H19N3OS2 — CID 87417720
2-cyclopentyl-3-(6-sulfanylidene-1H-pyridin-3-yl)-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 87417720) has the molecular formula C16H19N3OS2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 2-cyclopentyl-3-(6-sulfanylidene-1H-pyridin-3-yl)-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 2-cyclopentyl-3-(6-sulfanylidene-1H-pyridin-3-yl)-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 87417720 |
| Molecular Formula | C16H19N3OS2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 2-cyclopentyl-3-(6-sulfanylidene-1H-pyridin-3-yl)-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | O=C(Nc1nccs1)C(Cc1ccc(=S)[nH]c1)C1CCCC1 |
| InChI | InChI=1S/C16H19N3OS2/c20-15(19-16-17-7-8-22-16)13(12-3-1-2-4-12)9-11-5-6-14(21)18-10-11/h5-8,10,12-13H,1-4,9H2,(H,18,21)(H,17,19,20) |
| InChIKey | LXPPHLSBVPCLLV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|