C29H27ClF3N7O2 — CID 87419767
4-[[amino-[(3Z)-2-(4-chlorophenyl)-5-[4-(trifluoromethoxy)phenyl]hexa-3,5-dien-3-yl]amino]methyl]-N-(2H-tetrazol-5-ylmethyl)benzamide (PubChem CID 87419767) has the molecular formula C29H27ClF3N7O2 and a molecular weight of 598.03 g/mol. Its IUPAC name is 4-[[amino-[(3Z)-2-(4-chlorophenyl)-5-[4-(trifluoromethoxy)phenyl]hexa-3,5-dien-3-yl]amino]methyl]-N-(2H-tetrazol-5-ylmethyl)benzamide.
| Compound Name | 4-[[amino-[(3Z)-2-(4-chlorophenyl)-5-[4-(trifluoromethoxy)phenyl]hexa-3,5-dien-3-yl]amino]methyl]-N-(2H-tetrazol-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 87419767 |
| Molecular Formula | C29H27ClF3N7O2 |
| Molecular Weight | 598.03 g/mol |
| Exact Mass | 597.19 |
| IUPAC Name | 4-[[amino-[(3Z)-2-(4-chlorophenyl)-5-[4-(trifluoromethoxy)phenyl]hexa-3,5-dien-3-yl]amino]methyl]-N-(2H-tetrazol-5-ylmethyl)benzamide |
| SMILES | C=C(/C=C(/C(C)c1ccc(Cl)cc1)N(N)Cc1ccc(C(=O)NCc2nn[nH]n2)cc1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C29H27ClF3N7O2/c1-18(21-9-13-25(14-10-21)42-29(31,32)33)15-26(19(2)22-7-11-24(30)12-8-22)40(34)17-20-3-5-23(6-4-20)28(41)35-16-27-36-38-39-37-27/h3-15,19H,1,16-17,34H2,2H3,(H,35,41)(H,36,37,38,39)/b26-15- |
| InChIKey | TVQSULKUMCIJCV-YSMPRRRNSA-N |
| XLogP | 5.76 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.03 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|