C31H38O4 — CID 87427665
2-[1-[3-[4-[4-(oxiran-2-ylmethoxy)phenyl]cyclohexa-1,3-dien-1-yl]phenoxy]octyl]oxirane (PubChem CID 87427665) has the molecular formula C31H38O4 and a molecular weight of 474.64 g/mol. Its IUPAC name is 2-[1-[3-[4-[4-(oxiran-2-ylmethoxy)phenyl]cyclohexa-1,3-dien-1-yl]phenoxy]octyl]oxirane.
| Compound Name | 2-[1-[3-[4-[4-(oxiran-2-ylmethoxy)phenyl]cyclohexa-1,3-dien-1-yl]phenoxy]octyl]oxirane |
|---|---|
| PubChem CID | 87427665 |
| Molecular Formula | C31H38O4 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | 2-[1-[3-[4-[4-(oxiran-2-ylmethoxy)phenyl]cyclohexa-1,3-dien-1-yl]phenoxy]octyl]oxirane |
| SMILES | CCCCCCCC(Oc1cccc(C2=CC=C(c3ccc(OCC4CO4)cc3)CC2)c1)C1CO1 |
| InChI | InChI=1S/C31H38O4/c1-2-3-4-5-6-10-30(31-22-34-31)35-28-9-7-8-26(19-28)25-13-11-23(12-14-25)24-15-17-27(18-16-24)32-20-29-21-33-29/h7-9,11,13,15-19,29-31H,2-6,10,12,14,20-22H2,1H3 |
| InChIKey | NQLBELBJDUXINS-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|