C32H40O4 — CID 87633294
2-[cyclooctyl-[3-[4-[4-(oxiran-2-ylmethoxy)phenyl]cyclohexen-1-yl]phenoxy]methyl]oxirane (PubChem CID 87633294) has the molecular formula C32H40O4 and a molecular weight of 488.67 g/mol. Its IUPAC name is 2-[cyclooctyl-[3-[4-[4-(oxiran-2-ylmethoxy)phenyl]cyclohexen-1-yl]phenoxy]methyl]oxirane.
| Compound Name | 2-[cyclooctyl-[3-[4-[4-(oxiran-2-ylmethoxy)phenyl]cyclohexen-1-yl]phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 87633294 |
| Molecular Formula | C32H40O4 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | 2-[cyclooctyl-[3-[4-[4-(oxiran-2-ylmethoxy)phenyl]cyclohexen-1-yl]phenoxy]methyl]oxirane |
| SMILES | C1=C(c2cccc(OC(C3CCCCCCC3)C3CO3)c2)CCC(c2ccc(OCC3CO3)cc2)C1 |
| InChI | InChI=1S/C32H40O4/c1-2-4-7-26(8-5-3-1)32(31-22-35-31)36-29-10-6-9-27(19-29)25-13-11-23(12-14-25)24-15-17-28(18-16-24)33-20-30-21-34-30/h6,9-10,13,15-19,23,26,30-32H,1-5,7-8,11-12,14,20-22H2 |
| InChIKey | KQRQJEXJUOLZFO-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|