C12H13F6N3O3S — CID 87429684
1-(1,1,2,3,3,3-hexafluoro-2-methylpropyl)-1-[(2-methylphenyl)sulfonylamino]urea (PubChem CID 87429684) has the molecular formula C12H13F6N3O3S and a molecular weight of 393.31 g/mol. Its IUPAC name is 1-(1,1,2,3,3,3-hexafluoro-2-methylpropyl)-1-[(2-methylphenyl)sulfonylamino]urea.
| Compound Name | 1-(1,1,2,3,3,3-hexafluoro-2-methylpropyl)-1-[(2-methylphenyl)sulfonylamino]urea |
|---|---|
| PubChem CID | 87429684 |
| Molecular Formula | C12H13F6N3O3S |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 1-(1,1,2,3,3,3-hexafluoro-2-methylpropyl)-1-[(2-methylphenyl)sulfonylamino]urea |
| SMILES | Cc1ccccc1S(=O)(=O)NN(C(N)=O)C(F)(F)C(C)(F)C(F)(F)F |
| InChI | InChI=1S/C12H13F6N3O3S/c1-7-5-3-4-6-8(7)25(23,24)20-21(9(19)22)12(17,18)10(2,13)11(14,15)16/h3-6,20H,1-2H3,(H2,19,22) |
| InChIKey | BKXLXDPKXAXIBX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|