C11H12F3NO5S — CID 2330840
methyl (2S)-3,3,3-trifluoro-2-hydroxy-2-[(2-methylphenyl)sulfonylamino]propanoate (PubChem CID 2330840) has the molecular formula C11H12F3NO5S and a molecular weight of 327.28 g/mol. Its IUPAC name is methyl (2S)-3,3,3-trifluoro-2-hydroxy-2-[(2-methylphenyl)sulfonylamino]propanoate.
| Compound Name | methyl (2S)-3,3,3-trifluoro-2-hydroxy-2-[(2-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 2330840 |
| Molecular Formula | C11H12F3NO5S |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | methyl (2S)-3,3,3-trifluoro-2-hydroxy-2-[(2-methylphenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)[C@@](O)(NS(=O)(=O)c1ccccc1C)C(F)(F)F |
| InChI | InChI=1S/C11H12F3NO5S/c1-7-5-3-4-6-8(7)21(18,19)15-10(17,9(16)20-2)11(12,13)14/h3-6,15,17H,1-2H3/t10-/m0/s1 |
| InChIKey | AVNBXYJXEQOLKS-JTQLQIEISA-N |
| XLogP | 0.70 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|