C12H29NO6P+ — CID 87433406
2-amino-2-(hydroxymethyl)propane-1,3-diol;2-ethylhexoxy-hydroxy-oxophosphanium (PubChem CID 87433406) has the molecular formula C12H29NO6P+ and a molecular weight of 314.34 g/mol. Its IUPAC name is 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-ethylhexoxy-hydroxy-oxophosphanium.
| Compound Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-ethylhexoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 87433406 |
| Molecular Formula | C12H29NO6P+ |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-ethylhexoxy-hydroxy-oxophosphanium |
| SMILES | CCCCC(CC)CO[P+](=O)O.NC(CO)(CO)CO |
| InChI | InChI=1S/C8H17O3P.C4H11NO3/c1-3-5-6-8(4-2)7-11-12(9)10;5-4(1-6,2-7)3-8/h8H,3-7H2,1-2H3;6-8H,1-3,5H2/p+1 |
| InChIKey | XNVMAPXWIWJXHX-UHFFFAOYSA-O |
| XLogP | 0.53 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|