C18H38Br3NO9P2 — CID 87436269
[amino-(5-bromo-4-hydroxy-4-methylpentoxy)phosphoryl] bis(5-bromo-4-hydroxy-4-methylpentyl) phosphate (PubChem CID 87436269) has the molecular formula C18H38Br3NO9P2 and a molecular weight of 714.16 g/mol. Its IUPAC name is [amino-(5-bromo-4-hydroxy-4-methylpentoxy)phosphoryl] bis(5-bromo-4-hydroxy-4-methylpentyl) phosphate.
| Compound Name | [amino-(5-bromo-4-hydroxy-4-methylpentoxy)phosphoryl] bis(5-bromo-4-hydroxy-4-methylpentyl) phosphate |
|---|---|
| PubChem CID | 87436269 |
| Molecular Formula | C18H38Br3NO9P2 |
| Molecular Weight | 714.16 g/mol |
| Exact Mass | 710.96 |
| IUPAC Name | [amino-(5-bromo-4-hydroxy-4-methylpentoxy)phosphoryl] bis(5-bromo-4-hydroxy-4-methylpentyl) phosphate |
| SMILES | CC(O)(CBr)CCCOP(N)(=O)OP(=O)(OCCCC(C)(O)CBr)OCCCC(C)(O)CBr |
| InChI | InChI=1S/C18H38Br3NO9P2/c1-16(23,13-19)7-4-10-28-32(22,26)31-33(27,29-11-5-8-17(2,24)14-20)30-12-6-9-18(3,25)15-21/h23-25H,4-15H2,1-3H3,(H2,22,26) |
| InChIKey | ONNRYXKGXFJVCI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 157.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.16 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|