C8H12F6O7 — CID 87449319
2,2,3,3,3-pentakis(fluoromethoxy)propanoic acid;hydrofluoride (PubChem CID 87449319) has the molecular formula C8H12F6O7 and a molecular weight of 334.17 g/mol. Its IUPAC name is 2,2,3,3,3-pentakis(fluoromethoxy)propanoic acid;hydrofluoride.
| Compound Name | 2,2,3,3,3-pentakis(fluoromethoxy)propanoic acid;hydrofluoride |
|---|---|
| PubChem CID | 87449319 |
| Molecular Formula | C8H12F6O7 |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 2,2,3,3,3-pentakis(fluoromethoxy)propanoic acid;hydrofluoride |
| SMILES | F.O=C(O)C(OCF)(OCF)C(OCF)(OCF)OCF |
| InChI | InChI=1S/C8H11F5O7.FH/c9-1-16-7(6(14)15,17-2-10)8(18-3-11,19-4-12)20-5-13;/h1-5H2,(H,14,15);1H |
| InChIKey | DIJUBSRHETZZTO-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|