C17H13Cl3N2O3 — CID 87451831
ethyl 1-benzyl-2,3,7-trichloro-4-hydroxypyrrolo[2,3-c]pyridine-5-carboxylate (PubChem CID 87451831) has the molecular formula C17H13Cl3N2O3 and a molecular weight of 399.66 g/mol. Its IUPAC name is ethyl 1-benzyl-2,3,7-trichloro-4-hydroxypyrrolo[2,3-c]pyridine-5-carboxylate.
| Compound Name | ethyl 1-benzyl-2,3,7-trichloro-4-hydroxypyrrolo[2,3-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 87451831 |
| Molecular Formula | C17H13Cl3N2O3 |
| Molecular Weight | 399.66 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | ethyl 1-benzyl-2,3,7-trichloro-4-hydroxypyrrolo[2,3-c]pyridine-5-carboxylate |
| SMILES | CCOC(=O)c1nc(Cl)c2c(c1O)c(Cl)c(Cl)n2Cc1ccccc1 |
| InChI | InChI=1S/C17H13Cl3N2O3/c1-2-25-17(24)12-14(23)10-11(18)16(20)22(13(10)15(19)21-12)8-9-6-4-3-5-7-9/h3-7,23H,2,8H2,1H3 |
| InChIKey | RRNUQDFCBQOWRX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.66 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|