C17H24O4 — CID 87453061
2-hydroxybenzoic acid;3,3,5-trimethylcyclohexane-1-carbaldehyde (PubChem CID 87453061) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-hydroxybenzoic acid;3,3,5-trimethylcyclohexane-1-carbaldehyde.
| Compound Name | 2-hydroxybenzoic acid;3,3,5-trimethylcyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 87453061 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 2-hydroxybenzoic acid;3,3,5-trimethylcyclohexane-1-carbaldehyde |
| SMILES | CC1CC(C=O)CC(C)(C)C1.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C10H18O.C7H6O3/c1-8-4-9(7-11)6-10(2,3)5-8;8-6-4-2-1-3-5(6)7(9)10/h7-9H,4-6H2,1-3H3;1-4,8H,(H,9,10) |
| InChIKey | VCINNWCAQIFNAD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|