C16H22O3 — CID 66602392
2-hydroxy-3-(3,3,5-trimethylcyclohexyl)benzoic acid (PubChem CID 66602392) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-hydroxy-3-(3,3,5-trimethylcyclohexyl)benzoic acid.
| Compound Name | 2-hydroxy-3-(3,3,5-trimethylcyclohexyl)benzoic acid |
|---|---|
| PubChem CID | 66602392 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 2-hydroxy-3-(3,3,5-trimethylcyclohexyl)benzoic acid |
| SMILES | CC1CC(c2cccc(C(=O)O)c2O)CC(C)(C)C1 |
| InChI | InChI=1S/C16H22O3/c1-10-7-11(9-16(2,3)8-10)12-5-4-6-13(14(12)17)15(18)19/h4-6,10-11,17H,7-9H2,1-3H3,(H,18,19) |
| InChIKey | GGXOTIZMRSEMHF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |