C26H38O4 — CID 90952057
4-[(1S,5S)-3,3,5-trimethylcyclohexyl]-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]phthalic acid (PubChem CID 90952057) has the molecular formula C26H38O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is 4-[(1S,5S)-3,3,5-trimethylcyclohexyl]-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]phthalic acid.
| Compound Name | 4-[(1S,5S)-3,3,5-trimethylcyclohexyl]-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]phthalic acid |
|---|---|
| PubChem CID | 90952057 |
| Molecular Formula | C26H38O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | 4-[(1S,5S)-3,3,5-trimethylcyclohexyl]-3-[(1R,5R)-3,3,5-trimethylcyclohexyl]phthalic acid |
| SMILES | C[C@@H]1C[C@@H](c2c([C@H]3C[C@H](C)CC(C)(C)C3)ccc(C(=O)O)c2C(=O)O)CC(C)(C)C1 |
| InChI | InChI=1S/C26H38O4/c1-15-9-17(13-25(3,4)11-15)19-7-8-20(23(27)28)22(24(29)30)21(19)18-10-16(2)12-26(5,6)14-18/h7-8,15-18H,9-14H2,1-6H3,(H,27,28)(H,29,30)/t15-,16+,17-,18+/m0/s1 |
| InChIKey | TUIJLMKIOPXQGI-XWTMOSNGSA-N |
| XLogP | 6.94 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |