C21H23N3O3S — CID 87455390
[2-(3-methoxyfuro[3,2-b]pyridine-2-carbonyl)-3-pentylphenyl]thiourea (PubChem CID 87455390) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is [2-(3-methoxyfuro[3,2-b]pyridine-2-carbonyl)-3-pentylphenyl]thiourea.
| Compound Name | [2-(3-methoxyfuro[3,2-b]pyridine-2-carbonyl)-3-pentylphenyl]thiourea |
|---|---|
| PubChem CID | 87455390 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | [2-(3-methoxyfuro[3,2-b]pyridine-2-carbonyl)-3-pentylphenyl]thiourea |
| SMILES | CCCCCc1cccc(NC(N)=S)c1C(=O)c1oc2cccnc2c1OC |
| InChI | InChI=1S/C21H23N3O3S/c1-3-4-5-8-13-9-6-10-14(24-21(22)28)16(13)18(25)20-19(26-2)17-15(27-20)11-7-12-23-17/h6-7,9-12H,3-5,8H2,1-2H3,(H3,22,24,28) |
| InChIKey | KULWKLZGQMKSNW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|