C20H21N3O2S — CID 87457947
[2-(furo[2,3-b]pyridine-2-carbonyl)-3-pentylphenyl]thiourea (PubChem CID 87457947) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is [2-(furo[2,3-b]pyridine-2-carbonyl)-3-pentylphenyl]thiourea.
| Compound Name | [2-(furo[2,3-b]pyridine-2-carbonyl)-3-pentylphenyl]thiourea |
|---|---|
| PubChem CID | 87457947 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | [2-(furo[2,3-b]pyridine-2-carbonyl)-3-pentylphenyl]thiourea |
| SMILES | CCCCCc1cccc(NC(N)=S)c1C(=O)c1cc2cccnc2o1 |
| InChI | InChI=1S/C20H21N3O2S/c1-2-3-4-7-13-8-5-10-15(23-20(21)26)17(13)18(24)16-12-14-9-6-11-22-19(14)25-16/h5-6,8-12H,2-4,7H2,1H3,(H3,21,23,26) |
| InChIKey | WTLHUDCHBVLMNI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|