C20H21N3O3S — CID 87458314
[2-(furo[2,3-b]pyridine-2-carbonyl)-3-pentoxyphenyl]thiourea (PubChem CID 87458314) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is [2-(furo[2,3-b]pyridine-2-carbonyl)-3-pentoxyphenyl]thiourea.
| Compound Name | [2-(furo[2,3-b]pyridine-2-carbonyl)-3-pentoxyphenyl]thiourea |
|---|---|
| PubChem CID | 87458314 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | [2-(furo[2,3-b]pyridine-2-carbonyl)-3-pentoxyphenyl]thiourea |
| SMILES | CCCCCOc1cccc(NC(N)=S)c1C(=O)c1cc2cccnc2o1 |
| InChI | InChI=1S/C20H21N3O3S/c1-2-3-4-11-25-15-9-5-8-14(23-20(21)27)17(15)18(24)16-12-13-7-6-10-22-19(13)26-16/h5-10,12H,2-4,11H2,1H3,(H3,21,23,27) |
| InChIKey | NRRXQEMLDJLGKO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|