About ethyl(trimethyl)azanium;fluoro difluoromethanesulfonate
ethyl(trimethyl)azanium;fluoro difluoromethanesulfonate (PubChem CID 87457651) has the molecular formula C6H15F3NO3S+
and a molecular weight of 238.25 g/mol. Its IUPAC name is ethyl(trimethyl)azanium;fluoro difluoromethanesulfonate.
Molecular Properties
| Compound Name | ethyl(trimethyl)azanium;fluoro difluoromethanesulfonate |
| PubChem CID | 87457651 |
| Molecular Formula | C6H15F3NO3S+ |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | ethyl(trimethyl)azanium;fluoro difluoromethanesulfonate |
| SMILES | CC[N+](C)(C)C.O=S(=O)(OF)C(F)F |
| InChI | InChI=1S/C5H14N.CHF3O3S/c1-5-6(2,3)4;2-1(3)8(5,6)7-4/h5H2,1-4H3;1H/q+1; |
| InChIKey | NADCVECYVIDRIP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl(trimethyl)azanium;fluoro difluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl(trimethyl)azanium;fluoro difluoromethanesulfonate?
The IUPAC name of ethyl(trimethyl)azanium;fluoro difluoromethanesulfonate (CID 87457651) is ethyl(trimethyl)azanium;fluoro difluoromethanesulfonate.
What is the SMILES notation for ethyl(trimethyl)azanium;fluoro difluoromethanesulfonate?
The canonical SMILES for ethyl(trimethyl)azanium;fluoro difluoromethanesulfonate is CC[N+](C)(C)C.O=S(=O)(OF)C(F)F.
What is the InChIKey of ethyl(trimethyl)azanium;fluoro difluoromethanesulfonate?
The InChIKey is NADCVECYVIDRIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14N.CHF3O3S/c1-5-6(2,3)4;2-1(3)8(5,6)7-4/h5H2,1-4H3;1H/q+1;.
What are the key properties of ethyl(trimethyl)azanium;fluoro difluoromethanesulfonate?
ethyl(trimethyl)azanium;fluoro difluoromethanesulfonate has a molecular weight of 238.25 g/mol, XLogP of 1.15, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl(trimethyl)azanium;fluoro difluoromethanesulfonate is sourced from PubChem (CID 87457651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).