About fluoro ethanesulfonate;tetraethylazanium
fluoro ethanesulfonate;tetraethylazanium (PubChem CID 175189438) has the molecular formula C10H25FNO3S+
and a molecular weight of 258.38 g/mol. Its IUPAC name is fluoro ethanesulfonate;tetraethylazanium.
Molecular Properties
| Compound Name | fluoro ethanesulfonate;tetraethylazanium |
| PubChem CID | 175189438 |
| Molecular Formula | C10H25FNO3S+ |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | fluoro ethanesulfonate;tetraethylazanium |
| SMILES | CCS(=O)(=O)OF.CC[N+](CC)(CC)CC |
| InChI | InChI=1S/C8H20N.C2H5FO3S/c1-5-9(6-2,7-3)8-4;1-2-7(4,5)6-3/h5-8H2,1-4H3;2H2,1H3/q+1; |
| InChIKey | HKSPYFQHLUFFIX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze fluoro ethanesulfonate;tetraethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro ethanesulfonate;tetraethylazanium?
The IUPAC name of fluoro ethanesulfonate;tetraethylazanium (CID 175189438) is fluoro ethanesulfonate;tetraethylazanium.
What is the SMILES notation for fluoro ethanesulfonate;tetraethylazanium?
The canonical SMILES for fluoro ethanesulfonate;tetraethylazanium is CCS(=O)(=O)OF.CC[N+](CC)(CC)CC.
What is the InChIKey of fluoro ethanesulfonate;tetraethylazanium?
The InChIKey is HKSPYFQHLUFFIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N.C2H5FO3S/c1-5-9(6-2,7-3)8-4;1-2-7(4,5)6-3/h5-8H2,1-4H3;2H2,1H3/q+1;.
What are the key properties of fluoro ethanesulfonate;tetraethylazanium?
fluoro ethanesulfonate;tetraethylazanium has a molecular weight of 258.38 g/mol, XLogP of 2.12, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro ethanesulfonate;tetraethylazanium is sourced from PubChem (CID 175189438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).