C9H16N2O6S — CID 87458578
N-[4-(aminomethoxy)phenyl]-N-ethylhydroxylamine;sulfuric acid (PubChem CID 87458578) has the molecular formula C9H16N2O6S and a molecular weight of 280.30 g/mol. Its IUPAC name is N-[4-(aminomethoxy)phenyl]-N-ethylhydroxylamine;sulfuric acid.
| Compound Name | N-[4-(aminomethoxy)phenyl]-N-ethylhydroxylamine;sulfuric acid |
|---|---|
| PubChem CID | 87458578 |
| Molecular Formula | C9H16N2O6S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | N-[4-(aminomethoxy)phenyl]-N-ethylhydroxylamine;sulfuric acid |
| SMILES | CCN(O)c1ccc(OCN)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/C9H14N2O2.H2O4S/c1-2-11(12)8-3-5-9(6-4-8)13-7-10;1-5(2,3)4/h3-6,12H,2,7,10H2,1H3;(H2,1,2,3,4) |
| InChIKey | JXEPTDKRQQVRRX-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|