C19H30N3O6P — CID 87458948
ethyl 4-[(2S)-2-amino-2-(2-diethoxyphosphorylphenyl)acetyl]piperazine-1-carboxylate (PubChem CID 87458948) has the molecular formula C19H30N3O6P and a molecular weight of 427.44 g/mol. Its IUPAC name is ethyl 4-[(2S)-2-amino-2-(2-diethoxyphosphorylphenyl)acetyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(2S)-2-amino-2-(2-diethoxyphosphorylphenyl)acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 87458948 |
| Molecular Formula | C19H30N3O6P |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | ethyl 4-[(2S)-2-amino-2-(2-diethoxyphosphorylphenyl)acetyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)[C@@H](N)c2ccccc2P(=O)(OCC)OCC)CC1 |
| InChI | InChI=1S/C19H30N3O6P/c1-4-26-19(24)22-13-11-21(12-14-22)18(23)17(20)15-9-7-8-10-16(15)29(25,27-5-2)28-6-3/h7-10,17H,4-6,11-14,20H2,1-3H3/t17-/m0/s1 |
| InChIKey | AAFXFDKXGLYIQX-KRWDZBQOSA-N |
| XLogP | 1.88 |
| TPSA | 111.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|