C17H15Cl2NO5S — CID 87467256
3-[2-(2,4-dichlorophenoxy)ethyl]-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonic acid (PubChem CID 87467256) has the molecular formula C17H15Cl2NO5S and a molecular weight of 416.28 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenoxy)ethyl]-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonic acid.
| Compound Name | 3-[2-(2,4-dichlorophenoxy)ethyl]-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonic acid |
|---|---|
| PubChem CID | 87467256 |
| Molecular Formula | C17H15Cl2NO5S |
| Molecular Weight | 416.28 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | 3-[2-(2,4-dichlorophenoxy)ethyl]-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonic acid |
| SMILES | O=C1Nc2ccc(S(=O)(=O)O)cc2CC1CCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H15Cl2NO5S/c18-12-1-4-16(14(19)9-12)25-6-5-10-7-11-8-13(26(22,23)24)2-3-15(11)20-17(10)21/h1-4,8-10H,5-7H2,(H,20,21)(H,22,23,24) |
| InChIKey | QCNLHHBXOFAHHZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.28 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|