C20H27BrN2O6 — CID 87471124
(2S)-2-[[(2S)-2-amino-2-benzyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoyl]amino]-6-bromo-5-oxohexanoic acid (PubChem CID 87471124) has the molecular formula C20H27BrN2O6 and a molecular weight of 471.35 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-2-benzyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoyl]amino]-6-bromo-5-oxohexanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-amino-2-benzyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoyl]amino]-6-bromo-5-oxohexanoic acid |
|---|---|
| PubChem CID | 87471124 |
| Molecular Formula | C20H27BrN2O6 |
| Molecular Weight | 471.35 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-2-benzyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoyl]amino]-6-bromo-5-oxohexanoic acid |
| SMILES | CC(C)(C)OC(=O)[C@](N)(Cc1ccccc1)C(=O)N[C@@H](CCC(=O)CBr)C(=O)O |
| InChI | InChI=1S/C20H27BrN2O6/c1-19(2,3)29-18(28)20(22,11-13-7-5-4-6-8-13)17(27)23-15(16(25)26)10-9-14(24)12-21/h4-8,15H,9-12,22H2,1-3H3,(H,23,27)(H,25,26)/t15-,20-/m0/s1 |
| InChIKey | LUPQFSYVFAMZFH-YWZLYKJASA-N |
| XLogP | 1.58 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|