About 2-methylpropyl (5S)-5-[[dimethylcarbamoyl(methyl)carbamoyl]-methylamino]-2-hydroxy-4-oxohexanoate
2-methylpropyl (5S)-5-[[dimethylcarbamoyl(methyl)carbamoyl]-methylamino]-2-hydroxy-4-oxohexanoate (PubChem CID 87471347) has the molecular formula C16H29N3O6
and a molecular weight of 359.42 g/mol. Its IUPAC name is 2-methylpropyl (5S)-5-[[dimethylcarbamoyl(methyl)carbamoyl]-methylamino]-2-hydroxy-4-oxohexanoate.
Molecular Properties
| Compound Name | 2-methylpropyl (5S)-5-[[dimethylcarbamoyl(methyl)carbamoyl]-methylamino]-2-hydroxy-4-oxohexanoate |
| PubChem CID | 87471347 |
| Molecular Formula | C16H29N3O6 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 2-methylpropyl (5S)-5-[[dimethylcarbamoyl(methyl)carbamoyl]-methylamino]-2-hydroxy-4-oxohexanoate |
| SMILES | CC(C)COC(=O)C(O)CC(=O)[C@H](C)N(C)C(=O)N(C)C(=O)N(C)C |
| InChI | InChI=1S/C16H29N3O6/c1-10(2)9-25-14(22)13(21)8-12(20)11(3)18(6)16(24)19(7)15(23)17(4)5/h10-11,13,21H,8-9H2,1-7H3/t11-,13?/m0/s1 |
| InChIKey | YEHJMQNOBKHVOY-AMGKYWFPSA-N |
| XLogP | 0.56 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methylpropyl (5S)-5-[[dimethylcarbamoyl(methyl)carbamoyl]-methylamino]-2-hydroxy-4-oxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl (5S)-5-[[dimethylcarbamoyl(methyl)carbamoyl]-methylamino]-2-hydroxy-4-oxohexanoate?
The IUPAC name of 2-methylpropyl (5S)-5-[[dimethylcarbamoyl(methyl)carbamoyl]-methylamino]-2-hydroxy-4-oxohexanoate (CID 87471347) is 2-methylpropyl (5S)-5-[[dimethylcarbamoyl(methyl)carbamoyl]-methylamino]-2-hydroxy-4-oxohexanoate.
What is the SMILES notation for 2-methylpropyl (5S)-5-[[dimethylcarbamoyl(methyl)carbamoyl]-methylamino]-2-hydroxy-4-oxohexanoate?
The canonical SMILES for 2-methylpropyl (5S)-5-[[dimethylcarbamoyl(methyl)carbamoyl]-methylamino]-2-hydroxy-4-oxohexanoate is CC(C)COC(=O)C(O)CC(=O)[C@H](C)N(C)C(=O)N(C)C(=O)N(C)C.
What is the InChIKey of 2-methylpropyl (5S)-5-[[dimethylcarbamoyl(methyl)carbamoyl]-methylamino]-2-hydroxy-4-oxohexanoate?
The InChIKey is YEHJMQNOBKHVOY-AMGKYWFPSA-N. The full InChI is InChI=1S/C16H29N3O6/c1-10(2)9-25-14(22)13(21)8-12(20)11(3)18(6)16(24)19(7)15(23)17(4)5/h10-11,13,21H,8-9H2,1-7H3/t11-,13?/m0/s1.
What are the key properties of 2-methylpropyl (5S)-5-[[dimethylcarbamoyl(methyl)carbamoyl]-methylamino]-2-hydroxy-4-oxohexanoate?
2-methylpropyl (5S)-5-[[dimethylcarbamoyl(methyl)carbamoyl]-methylamino]-2-hydroxy-4-oxohexanoate has a molecular weight of 359.42 g/mol, XLogP of 0.56, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl (5S)-5-[[dimethylcarbamoyl(methyl)carbamoyl]-methylamino]-2-hydroxy-4-oxohexanoate is sourced from PubChem (CID 87471347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).