About [dihydroxy(phenylimino)-λ5-phosphanyl] dihydrogen phosphate
[dihydroxy(phenylimino)-λ5-phosphanyl] dihydrogen phosphate (PubChem CID 87474721) has the molecular formula C6H9NO6P2
and a molecular weight of 253.09 g/mol. Its IUPAC name is [dihydroxy(phenylimino)-λ5-phosphanyl] dihydrogen phosphate.
Molecular Properties
| Compound Name | [dihydroxy(phenylimino)-λ5-phosphanyl] dihydrogen phosphate |
| PubChem CID | 87474721 |
| Molecular Formula | C6H9NO6P2 |
| Molecular Weight | 253.09 g/mol |
| Exact Mass | 252.99 |
| IUPAC Name | [dihydroxy(phenylimino)-λ5-phosphanyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OP(O)(O)=Nc1ccccc1 |
| InChI | InChI=1S/C6H9NO6P2/c8-14(9,13-15(10,11)12)7-6-4-2-1-3-5-6/h1-5,8-9H,(H2,10,11,12) |
| InChIKey | VVPKSLLAIHJJSX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 119.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.09 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [dihydroxy(phenylimino)-λ5-phosphanyl] dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dihydroxy(phenylimino)-λ5-phosphanyl] dihydrogen phosphate?
The IUPAC name of [dihydroxy(phenylimino)-λ5-phosphanyl] dihydrogen phosphate (CID 87474721) is [dihydroxy(phenylimino)-λ5-phosphanyl] dihydrogen phosphate.
What is the SMILES notation for [dihydroxy(phenylimino)-λ5-phosphanyl] dihydrogen phosphate?
The canonical SMILES for [dihydroxy(phenylimino)-λ5-phosphanyl] dihydrogen phosphate is O=P(O)(O)OP(O)(O)=Nc1ccccc1.
What is the InChIKey of [dihydroxy(phenylimino)-λ5-phosphanyl] dihydrogen phosphate?
The InChIKey is VVPKSLLAIHJJSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO6P2/c8-14(9,13-15(10,11)12)7-6-4-2-1-3-5-6/h1-5,8-9H,(H2,10,11,12).
What are the key properties of [dihydroxy(phenylimino)-λ5-phosphanyl] dihydrogen phosphate?
[dihydroxy(phenylimino)-λ5-phosphanyl] dihydrogen phosphate has a molecular weight of 253.09 g/mol, XLogP of 1.36, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [dihydroxy(phenylimino)-λ5-phosphanyl] dihydrogen phosphate is sourced from PubChem (CID 87474721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).