C16H24O4S — CID 87475025
1-phenyldec-9-enyl hydrogen sulfate (PubChem CID 87475025) has the molecular formula C16H24O4S and a molecular weight of 312.43 g/mol. Its IUPAC name is 1-phenyldec-9-enyl hydrogen sulfate.
| Compound Name | 1-phenyldec-9-enyl hydrogen sulfate |
|---|---|
| PubChem CID | 87475025 |
| Molecular Formula | C16H24O4S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-phenyldec-9-enyl hydrogen sulfate |
| SMILES | C=CCCCCCCCC(OS(=O)(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H24O4S/c1-2-3-4-5-6-7-11-14-16(20-21(17,18)19)15-12-9-8-10-13-15/h2,8-10,12-13,16H,1,3-7,11,14H2,(H,17,18,19) |
| InChIKey | PHSYTWVFPVQNHN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|