C33H33O7S-3 — CID 59148495
3-(2-oxido-2-phenylethyl)-1,5-diphenyl-3-(2-phenyl-2-sulfooxyethyl)pentane-1,5-diolate (PubChem CID 59148495) has the molecular formula C33H33O7S-3 and a molecular weight of 573.69 g/mol. Its IUPAC name is 3-(2-oxido-2-phenylethyl)-1,5-diphenyl-3-(2-phenyl-2-sulfooxyethyl)pentane-1,5-diolate.
| Compound Name | 3-(2-oxido-2-phenylethyl)-1,5-diphenyl-3-(2-phenyl-2-sulfooxyethyl)pentane-1,5-diolate |
|---|---|
| PubChem CID | 59148495 |
| Molecular Formula | C33H33O7S-3 |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.20 |
| IUPAC Name | 3-(2-oxido-2-phenylethyl)-1,5-diphenyl-3-(2-phenyl-2-sulfooxyethyl)pentane-1,5-diolate |
| SMILES | O=S(=O)(O)OC(CC(CC([O-])c1ccccc1)(CC([O-])c1ccccc1)CC([O-])c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H33O7S/c34-29(25-13-5-1-6-14-25)21-33(22-30(35)26-15-7-2-8-16-26,23-31(36)27-17-9-3-10-18-27)24-32(40-41(37,38)39)28-19-11-4-12-20-28/h1-20,29-32H,21-24H2,(H,37,38,39)/q-3 |
| InChIKey | YLYAMZSVAWTYQN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 132.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|