C34H34O4S3 — CID 141009253
O-(2-methyl-1,1-diphenylpropan-2-yl) (2-methyl-1,1-diphenylpropan-2-yl)oxycarbothioylsulfonylmethanethioate (PubChem CID 141009253) has the molecular formula C34H34O4S3 and a molecular weight of 602.84 g/mol. Its IUPAC name is O-(2-methyl-1,1-diphenylpropan-2-yl) (2-methyl-1,1-diphenylpropan-2-yl)oxycarbothioylsulfonylmethanethioate.
| Compound Name | O-(2-methyl-1,1-diphenylpropan-2-yl) (2-methyl-1,1-diphenylpropan-2-yl)oxycarbothioylsulfonylmethanethioate |
|---|---|
| PubChem CID | 141009253 |
| Molecular Formula | C34H34O4S3 |
| Molecular Weight | 602.84 g/mol |
| Exact Mass | 602.16 |
| IUPAC Name | O-(2-methyl-1,1-diphenylpropan-2-yl) (2-methyl-1,1-diphenylpropan-2-yl)oxycarbothioylsulfonylmethanethioate |
| SMILES | CC(C)(OC(=S)S(=O)(=O)C(=S)OC(C)(C)C(c1ccccc1)c1ccccc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H34O4S3/c1-33(2,29(25-17-9-5-10-18-25)26-19-11-6-12-20-26)37-31(39)41(35,36)32(40)38-34(3,4)30(27-21-13-7-14-22-27)28-23-15-8-16-24-28/h5-24,29-30H,1-4H3 |
| InChIKey | WQILOJBDAMWDKD-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.84 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|