About O-carbamimidoyl N-butylcarbamothioate
O-carbamimidoyl N-butylcarbamothioate (PubChem CID 87476205) has the molecular formula C6H13N3OS
and a molecular weight of 175.26 g/mol. Its IUPAC name is O-carbamimidoyl N-butylcarbamothioate.
Molecular Properties
| Compound Name | O-carbamimidoyl N-butylcarbamothioate |
| PubChem CID | 87476205 |
| Molecular Formula | C6H13N3OS |
| Molecular Weight | 175.26 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | O-carbamimidoyl N-butylcarbamothioate |
| SMILES | [H]/N=C(\N)OC(=S)NCCCC |
| InChI | InChI=1S/C6H13N3OS/c1-2-3-4-9-6(11)10-5(7)8/h2-4H2,1H3,(H3,7,8)(H,9,11) |
| InChIKey | RDWOJMSYGJXGLP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 71.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-carbamimidoyl N-butylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-carbamimidoyl N-butylcarbamothioate?
The IUPAC name of O-carbamimidoyl N-butylcarbamothioate (CID 87476205) is O-carbamimidoyl N-butylcarbamothioate.
What is the SMILES notation for O-carbamimidoyl N-butylcarbamothioate?
The canonical SMILES for O-carbamimidoyl N-butylcarbamothioate is [H]/N=C(\N)OC(=S)NCCCC.
What is the InChIKey of O-carbamimidoyl N-butylcarbamothioate?
The InChIKey is RDWOJMSYGJXGLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3OS/c1-2-3-4-9-6(11)10-5(7)8/h2-4H2,1H3,(H3,7,8)(H,9,11).
What are the key properties of O-carbamimidoyl N-butylcarbamothioate?
O-carbamimidoyl N-butylcarbamothioate has a molecular weight of 175.26 g/mol, XLogP of 0.57, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-carbamimidoyl N-butylcarbamothioate is sourced from PubChem (CID 87476205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).