About butan-1-ol;2-ethylhexanoic acid;hydroxy(oxo)titanium
butan-1-ol;2-ethylhexanoic acid;hydroxy(oxo)titanium (PubChem CID 87479869) has the molecular formula C12H27O5Ti
and a molecular weight of 299.21 g/mol. Its IUPAC name is butan-1-ol;2-ethylhexanoic acid;hydroxy(oxo)titanium.
Molecular Properties
| Compound Name | butan-1-ol;2-ethylhexanoic acid;hydroxy(oxo)titanium |
| PubChem CID | 87479869 |
| Molecular Formula | C12H27O5Ti |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | butan-1-ol;2-ethylhexanoic acid;hydroxy(oxo)titanium |
| SMILES | CCCCC(CC)C(=O)O.CCCCO.O=[Ti]O |
| InChI | InChI=1S/C8H16O2.C4H10O.H2O.O.Ti/c1-3-5-6-7(4-2)8(9)10;1-2-3-4-5;;;/h7H,3-6H2,1-2H3,(H,9,10);5H,2-4H2,1H3;1H2;;/q;;;;+1/p-1 |
| InChIKey | CRISCBGJFZIFRF-UHFFFAOYSA-M |
| XLogP | 2.39 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze butan-1-ol;2-ethylhexanoic acid;hydroxy(oxo)titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-ol;2-ethylhexanoic acid;hydroxy(oxo)titanium?
The IUPAC name of butan-1-ol;2-ethylhexanoic acid;hydroxy(oxo)titanium (CID 87479869) is butan-1-ol;2-ethylhexanoic acid;hydroxy(oxo)titanium.
What is the SMILES notation for butan-1-ol;2-ethylhexanoic acid;hydroxy(oxo)titanium?
The canonical SMILES for butan-1-ol;2-ethylhexanoic acid;hydroxy(oxo)titanium is CCCCC(CC)C(=O)O.CCCCO.O=[Ti]O.
What is the InChIKey of butan-1-ol;2-ethylhexanoic acid;hydroxy(oxo)titanium?
The InChIKey is CRISCBGJFZIFRF-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16O2.C4H10O.H2O.O.Ti/c1-3-5-6-7(4-2)8(9)10;1-2-3-4-5;;;/h7H,3-6H2,1-2H3,(H,9,10);5H,2-4H2,1H3;1H2;;/q;;;;+1/p-1.
What are the key properties of butan-1-ol;2-ethylhexanoic acid;hydroxy(oxo)titanium?
butan-1-ol;2-ethylhexanoic acid;hydroxy(oxo)titanium has a molecular weight of 299.21 g/mol, XLogP of 2.39, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-ol;2-ethylhexanoic acid;hydroxy(oxo)titanium is sourced from PubChem (CID 87479869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).