C26H42ClN5OS — CID 87483218
4-[2-(dipropylamino)ethyl]-1,3-dihydroindol-2-one;(6S)-6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine;hydrochloride (PubChem CID 87483218) has the molecular formula C26H42ClN5OS and a molecular weight of 508.18 g/mol. Its IUPAC name is 4-[2-(dipropylamino)ethyl]-1,3-dihydroindol-2-one;(6S)-6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine;hydrochloride.
| Compound Name | 4-[2-(dipropylamino)ethyl]-1,3-dihydroindol-2-one;(6S)-6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine;hydrochloride |
|---|---|
| PubChem CID | 87483218 |
| Molecular Formula | C26H42ClN5OS |
| Molecular Weight | 508.18 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | 4-[2-(dipropylamino)ethyl]-1,3-dihydroindol-2-one;(6S)-6-N-propyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine;hydrochloride |
| SMILES | CCCN(CCC)CCc1cccc2c1CC(=O)N2.CCCN[C@H]1CCc2nc(N)sc2C1.Cl |
| InChI | InChI=1S/C16H24N2O.C10H17N3S.ClH/c1-3-9-18(10-4-2)11-8-13-6-5-7-15-14(13)12-16(19)17-15;1-2-5-12-7-3-4-8-9(6-7)14-10(11)13-8;/h5-7H,3-4,8-12H2,1-2H3,(H,17,19);7,12H,2-6H2,1H3,(H2,11,13);1H/t;7-;/m.0./s1 |
| InChIKey | TYWIWGBIVKLAAZ-IXSARBFQSA-N |
| XLogP | 4.85 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.18 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |